C19H20N6O4 — CID 135401172
13-amino-11-imino-4-[(3,4,5-trimethoxyphenyl)methyl]-4,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,5,9,12-tetraen-7-one (PubChem CID 135401172) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is 13-amino-11-imino-4-[(3,4,5-trimethoxyphenyl)methyl]-4,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,5,9,12-tetraen-7-one.
| Compound Name | 13-amino-11-imino-4-[(3,4,5-trimethoxyphenyl)methyl]-4,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,5,9,12-tetraen-7-one |
|---|---|
| PubChem CID | 135401172 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 13-amino-11-imino-4-[(3,4,5-trimethoxyphenyl)methyl]-4,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,5,9,12-tetraen-7-one |
| SMILES | [H]/N=C1\N=C(N)c2c3c(c(=O)[nH]c2=N1)=CN(Cc1cc(OC)c(OC)c(OC)c1)C3 |
| InChI | InChI=1S/C19H20N6O4/c1-27-12-4-9(5-13(28-2)15(12)29-3)6-25-7-10-11(8-25)18(26)23-17-14(10)16(20)22-19(21)24-17/h4-5,8H,6-7H2,1-3H3,(H4,20,21,22,23,24,26) |
| InChIKey | ZFDOVNNZOAFLGV-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 138.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|