About 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one
5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one (PubChem CID 135401328) has the molecular formula C23H16N2O3
and a molecular weight of 368.39 g/mol. Its IUPAC name is 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one.
Molecular Properties
| Compound Name | 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one |
| PubChem CID | 135401328 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one |
| SMILES | O=C(c1ccccc1)c1c(O)nc(-c2ccccc2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C23H16N2O3/c26-20(16-10-4-1-5-11-16)19-22(27)24-21(17-12-6-2-7-13-17)25(23(19)28)18-14-8-3-9-15-18/h1-15,27H |
| InChIKey | MKAIEPXFPFHYKF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one?
The IUPAC name of 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one (CID 135401328) is 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one.
What is the SMILES notation for 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one?
The canonical SMILES for 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one is O=C(c1ccccc1)c1c(O)nc(-c2ccccc2)n(-c2ccccc2)c1=O.
What is the InChIKey of 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one?
The InChIKey is MKAIEPXFPFHYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N2O3/c26-20(16-10-4-1-5-11-16)19-22(27)24-21(17-12-6-2-7-13-17)25(23(19)28)18-14-8-3-9-15-18/h1-15,27H.
What are the key properties of 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one?
5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one has a molecular weight of 368.39 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzoyl-6-hydroxy-2,3-diphenylpyrimidin-4-one is sourced from PubChem (CID 135401328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).