About N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide
N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide (PubChem CID 135401351) has the molecular formula C16H24N2O3
and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide.
Molecular Properties
| Compound Name | N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide |
| PubChem CID | 135401351 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide |
| SMILES | CCCCCCCC(=O)N/N=C(\C)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H24N2O3/c1-3-4-5-6-7-8-16(21)18-17-12(2)14-10-9-13(19)11-15(14)20/h9-11,19-20H,3-8H2,1-2H3,(H,18,21)/b17-12+ |
| InChIKey | JSISUOJMNNBRHL-SFQUDFHCSA-N |
| XLogP | 3.30 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide?
The IUPAC name of N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide (CID 135401351) is N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide.
What is the SMILES notation for N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide?
The canonical SMILES for N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide is CCCCCCCC(=O)N/N=C(\C)c1ccc(O)cc1O.
What is the InChIKey of N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide?
The InChIKey is JSISUOJMNNBRHL-SFQUDFHCSA-N. The full InChI is InChI=1S/C16H24N2O3/c1-3-4-5-6-7-8-16(21)18-17-12(2)14-10-9-13(19)11-15(14)20/h9-11,19-20H,3-8H2,1-2H3,(H,18,21)/b17-12+.
What are the key properties of N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide?
N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide has a molecular weight of 292.38 g/mol, XLogP of 3.30, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]octanamide is sourced from PubChem (CID 135401351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).