C18H23NO2 — CID 135401372
(2E)-2-(1-hydroxypropylidene)-5,5-dimethyl-3-(2-methylphenyl)iminocyclohexan-1-one (PubChem CID 135401372) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (2E)-2-(1-hydroxypropylidene)-5,5-dimethyl-3-(2-methylphenyl)iminocyclohexan-1-one.
| Compound Name | (2E)-2-(1-hydroxypropylidene)-5,5-dimethyl-3-(2-methylphenyl)iminocyclohexan-1-one |
|---|---|
| PubChem CID | 135401372 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2E)-2-(1-hydroxypropylidene)-5,5-dimethyl-3-(2-methylphenyl)iminocyclohexan-1-one |
| SMILES | CC/C(O)=C1\C(=O)CC(C)(C)C\C1=N/c1ccccc1C |
| InChI | InChI=1S/C18H23NO2/c1-5-15(20)17-14(10-18(3,4)11-16(17)21)19-13-9-7-6-8-12(13)2/h6-9,20H,5,10-11H2,1-4H3/b17-15+,19-14+ |
| InChIKey | MUGDZUFYWVFEQZ-UHOLLTQSSA-N |
| XLogP | 4.68 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|