C23H25NO3 — CID 135401396
3-hydroxy-2-[N-(2-methoxyphenyl)-C-propylcarbonimidoyl]-5-phenylcyclohex-2-en-1-one (PubChem CID 135401396) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-hydroxy-2-[N-(2-methoxyphenyl)-C-propylcarbonimidoyl]-5-phenylcyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-2-[N-(2-methoxyphenyl)-C-propylcarbonimidoyl]-5-phenylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135401396 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-hydroxy-2-[N-(2-methoxyphenyl)-C-propylcarbonimidoyl]-5-phenylcyclohex-2-en-1-one |
| SMILES | CCC/C(=N\c1ccccc1OC)C1=C(O)CC(c2ccccc2)CC1=O |
| InChI | InChI=1S/C23H25NO3/c1-3-9-19(24-18-12-7-8-13-22(18)27-2)23-20(25)14-17(15-21(23)26)16-10-5-4-6-11-16/h4-8,10-13,17,25H,3,9,14-15H2,1-2H3/b24-19+ |
| InChIKey | JHVOKYGOOLRRTD-LYBHJNIJSA-N |
| XLogP | 5.53 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|