About N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide
N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide (PubChem CID 135401421) has the molecular formula C18H19N3O3
and a molecular weight of 325.37 g/mol. Its IUPAC name is N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide.
Molecular Properties
| Compound Name | N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide |
| PubChem CID | 135401421 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)N/N=C/c1ccccc1O)NCc1ccccc1 |
| InChI | InChI=1S/C18H19N3O3/c22-16-9-5-4-8-15(16)13-20-21-18(24)11-10-17(23)19-12-14-6-2-1-3-7-14/h1-9,13,22H,10-12H2,(H,19,23)(H,21,24)/b20-13+ |
| InChIKey | XOHJUOZUJUJCKX-DEDYPNTBSA-N |
| XLogP | 1.94 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide?
The IUPAC name of N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide (CID 135401421) is N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide.
What is the SMILES notation for N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide?
The canonical SMILES for N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide is O=C(CCC(=O)N/N=C/c1ccccc1O)NCc1ccccc1.
What is the InChIKey of N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide?
The InChIKey is XOHJUOZUJUJCKX-DEDYPNTBSA-N. The full InChI is InChI=1S/C18H19N3O3/c22-16-9-5-4-8-15(16)13-20-21-18(24)11-10-17(23)19-12-14-6-2-1-3-7-14/h1-9,13,22H,10-12H2,(H,19,23)(H,21,24)/b20-13+.
What are the key properties of N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide?
N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide has a molecular weight of 325.37 g/mol, XLogP of 1.94, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-[(E)-(2-hydroxyphenyl)methylideneamino]butanediamide is sourced from PubChem (CID 135401421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).