About methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate
methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate (PubChem CID 135401496) has the molecular formula C18H17N5O3
and a molecular weight of 351.37 g/mol. Its IUPAC name is methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate.
Molecular Properties
| Compound Name | methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate |
| PubChem CID | 135401496 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate |
| SMILES | COC(=O)/C=C1/N/C(=N\c2nc(C)cc(C)n2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H17N5O3/c1-11-9-12(2)20-17(19-11)22-18-21-14(10-15(24)26-3)16(25)23(18)13-7-5-4-6-8-13/h4-10H,1-3H3,(H,19,20,21,22)/b14-10+ |
| InChIKey | PHGNDLWFBPEKOC-GXDHUFHOSA-N |
| XLogP | 1.77 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate?
The IUPAC name of methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate (CID 135401496) is methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate.
What is the SMILES notation for methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate?
The canonical SMILES for methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate is COC(=O)/C=C1/N/C(=N\c2nc(C)cc(C)n2)N(c2ccccc2)C1=O.
What is the InChIKey of methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate?
The InChIKey is PHGNDLWFBPEKOC-GXDHUFHOSA-N. The full InChI is InChI=1S/C18H17N5O3/c1-11-9-12(2)20-17(19-11)22-18-21-14(10-15(24)26-3)16(25)23(18)13-7-5-4-6-8-13/h4-10H,1-3H3,(H,19,20,21,22)/b14-10+.
What are the key properties of methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate?
methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate has a molecular weight of 351.37 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-2-[(2E)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxo-1-phenylimidazolidin-4-ylidene]acetate is sourced from PubChem (CID 135401496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).