About 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one
3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one (PubChem CID 135401616) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one |
| PubChem CID | 135401616 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C(/C=N/c2ccccc2)=C(O)C1 |
| InChI | InChI=1S/C15H17NO2/c1-15(2)8-13(17)12(14(18)9-15)10-16-11-6-4-3-5-7-11/h3-7,10,17H,8-9H2,1-2H3/b16-10+ |
| InChIKey | WUDXQKBKKYVSNS-MHWRWJLKSA-N |
| XLogP | 3.59 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one?
The IUPAC name of 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one (CID 135401616) is 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one.
What is the SMILES notation for 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one?
The canonical SMILES for 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one is CC1(C)CC(=O)C(/C=N/c2ccccc2)=C(O)C1.
What is the InChIKey of 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one?
The InChIKey is WUDXQKBKKYVSNS-MHWRWJLKSA-N. The full InChI is InChI=1S/C15H17NO2/c1-15(2)8-13(17)12(14(18)9-15)10-16-11-6-4-3-5-7-11/h3-7,10,17H,8-9H2,1-2H3/b16-10+.
What are the key properties of 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one?
3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one has a molecular weight of 243.31 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-5,5-dimethyl-2-(phenyliminomethyl)cyclohex-2-en-1-one is sourced from PubChem (CID 135401616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).