About 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol
2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol (PubChem CID 135401708) has the molecular formula C19H13FN2O2
and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol |
| PubChem CID | 135401708 |
| Molecular Formula | C19H13FN2O2 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol |
| SMILES | CC1=Nc2ccccc2/C1=C\c1nc(-c2ccc(F)cc2)oc1O |
| InChI | InChI=1S/C19H13FN2O2/c1-11-15(14-4-2-3-5-16(14)21-11)10-17-19(23)24-18(22-17)12-6-8-13(20)9-7-12/h2-10,23H,1H3/b15-10- |
| InChIKey | XLGVUVBZJBIFPZ-GDNBJRDFSA-N |
| XLogP | 4.83 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol?
The IUPAC name of 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol (CID 135401708) is 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol.
What is the SMILES notation for 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol?
The canonical SMILES for 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol is CC1=Nc2ccccc2/C1=C\c1nc(-c2ccc(F)cc2)oc1O.
What is the InChIKey of 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol?
The InChIKey is XLGVUVBZJBIFPZ-GDNBJRDFSA-N. The full InChI is InChI=1S/C19H13FN2O2/c1-11-15(14-4-2-3-5-16(14)21-11)10-17-19(23)24-18(22-17)12-6-8-13(20)9-7-12/h2-10,23H,1H3/b15-10-.
What are the key properties of 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol?
2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol has a molecular weight of 320.32 g/mol, XLogP of 4.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-4-[(E)-(2-methylindol-3-ylidene)methyl]-1,3-oxazol-5-ol is sourced from PubChem (CID 135401708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).