C19H17I2NO — CID 135401854
2,6-diiodo-4-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,5-dien-1-one (PubChem CID 135401854) has the molecular formula C19H17I2NO and a molecular weight of 529.16 g/mol. Its IUPAC name is 2,6-diiodo-4-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-diiodo-4-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 135401854 |
| Molecular Formula | C19H17I2NO |
| Molecular Weight | 529.16 g/mol |
| Exact Mass | 528.94 |
| IUPAC Name | 2,6-diiodo-4-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CN1C(=CC=C2C=C(I)C(=O)C(I)=C2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H17I2NO/c1-19(2)13-6-4-5-7-16(13)22(3)17(19)9-8-12-10-14(20)18(23)15(21)11-12/h4-11H,1-3H3 |
| InChIKey | DOLNQNSRVTWJBP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.16 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|