C20H15N5O2 — CID 135401910
(NE)-N-[5-[(2-pyrimidin-2-ylfuro[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 135401910) has the molecular formula C20H15N5O2 and a molecular weight of 357.37 g/mol. Its IUPAC name is (NE)-N-[5-[(2-pyrimidin-2-ylfuro[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[5-[(2-pyrimidin-2-ylfuro[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135401910 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (NE)-N-[5-[(2-pyrimidin-2-ylfuro[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | O/N=C1\CCc2cc(Nc3c(-c4ncccn4)oc4cnccc34)ccc21 |
| InChI | InChI=1S/C20H15N5O2/c26-25-16-5-2-12-10-13(3-4-14(12)16)24-18-15-6-9-21-11-17(15)27-19(18)20-22-7-1-8-23-20/h1,3-4,6-11,24,26H,2,5H2/b25-16+ |
| InChIKey | LURMQHFSSZDCGM-PCLIKHOPSA-N |
| XLogP | 4.15 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|