C20H16N4O3 — CID 135401911
(NE)-N-[5-[[2-(5-methyl-1,2-oxazol-3-yl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 135401911) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is (NE)-N-[5-[[2-(5-methyl-1,2-oxazol-3-yl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[5-[[2-(5-methyl-1,2-oxazol-3-yl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135401911 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (NE)-N-[5-[[2-(5-methyl-1,2-oxazol-3-yl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | Cc1cc(-c2oc3cnccc3c2Nc2ccc3c(c2)CC/C3=N\O)no1 |
| InChI | InChI=1S/C20H16N4O3/c1-11-8-17(24-27-11)20-19(15-6-7-21-10-18(15)26-20)22-13-3-4-14-12(9-13)2-5-16(14)23-25/h3-4,6-10,22,25H,2,5H2,1H3/b23-16+ |
| InChIKey | MZKDXQUIMHDHKF-XQNSMLJCSA-N |
| XLogP | 4.66 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|