C9H13N5O3 — CID 135402011
2-amino-6-(1,2-dihydroxypropyl)-7,8-dihydro-3H-pteridin-4-one (PubChem CID 135402011) has the molecular formula C9H13N5O3 and a molecular weight of 239.24 g/mol. Its IUPAC name is 2-amino-6-(1,2-dihydroxypropyl)-7,8-dihydro-3H-pteridin-4-one.
| Compound Name | 2-amino-6-(1,2-dihydroxypropyl)-7,8-dihydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135402011 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-amino-6-(1,2-dihydroxypropyl)-7,8-dihydro-3H-pteridin-4-one |
| SMILES | CC(O)C(O)C1=Nc2c(nc(N)[nH]c2=O)NC1 |
| InChI | InChI=1S/C9H13N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3,6,15-16H,2H2,1H3,(H4,10,11,13,14,17) |
| InChIKey | FEMXZDUTFRTWPE-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 136.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |