C28H22N10 — CID 135402153
1-[2-[2-(7-amino-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)phenyl]phenyl]-3-(6-phenylpyridazin-3-yl)guanidine (PubChem CID 135402153) has the molecular formula C28H22N10 and a molecular weight of 498.55 g/mol. Its IUPAC name is 1-[2-[2-(7-amino-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)phenyl]phenyl]-3-(6-phenylpyridazin-3-yl)guanidine.
| Compound Name | 1-[2-[2-(7-amino-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)phenyl]phenyl]-3-(6-phenylpyridazin-3-yl)guanidine |
|---|---|
| PubChem CID | 135402153 |
| Molecular Formula | C28H22N10 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-[2-[2-(7-amino-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)phenyl]phenyl]-3-(6-phenylpyridazin-3-yl)guanidine |
| SMILES | [H]/N=C(\Nc1ccc(-c2ccccc2)nn1)Nc1ccccc1-c1ccccc1-c1cnc2ncnn2c1N |
| InChI | InChI=1S/C28H22N10/c29-26-22(16-31-28-32-17-33-38(26)28)20-11-5-4-10-19(20)21-12-6-7-13-24(21)34-27(30)35-25-15-14-23(36-37-25)18-8-2-1-3-9-18/h1-17H,29H2,(H3,30,34,35,37) |
| InChIKey | GRTWAAFTZXOGHB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|