C17H15N3O — CID 135402212
4,6-bis(4-methylphenyl)-1H-1,3,5-triazin-2-one (PubChem CID 135402212) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 4,6-bis(4-methylphenyl)-1H-1,3,5-triazin-2-one.
| Compound Name | 4,6-bis(4-methylphenyl)-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135402212 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 4,6-bis(4-methylphenyl)-1H-1,3,5-triazin-2-one |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)[nH]c(=O)n2)cc1 |
| InChI | InChI=1S/C17H15N3O/c1-11-3-7-13(8-4-11)15-18-16(20-17(21)19-15)14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H,18,19,20,21) |
| InChIKey | GJGALUVMFKSLDF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |