C25H29N5O3 — CID 135402385
1,7-dibenzyl-3-methyl-8-(oxolan-2-ylmethylimino)-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 135402385) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1,7-dibenzyl-3-methyl-8-(oxolan-2-ylmethylimino)-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 1,7-dibenzyl-3-methyl-8-(oxolan-2-ylmethylimino)-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 135402385 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1,7-dibenzyl-3-methyl-8-(oxolan-2-ylmethylimino)-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | CN1C(=O)N(Cc2ccccc2)C(=O)C2C1N/C(=N\CC1CCCO1)N2Cc1ccccc1 |
| InChI | InChI=1S/C25H29N5O3/c1-28-22-21(23(31)30(25(28)32)17-19-11-6-3-7-12-19)29(16-18-9-4-2-5-10-18)24(27-22)26-15-20-13-8-14-33-20/h2-7,9-12,20-22H,8,13-17H2,1H3,(H,26,27) |
| InChIKey | YTNJQVXMIQNRKJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|