About 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate
4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate (PubChem CID 135402571) has the molecular formula C18H17N3O6S
and a molecular weight of 403.42 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate.
Molecular Properties
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate |
| PubChem CID | 135402571 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate |
| SMILES | O=C(OCCCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H17N3O6S/c22-18(13-7-9-14(10-8-13)21(23)24)27-12-4-3-11-19-17-15-5-1-2-6-16(15)28(25,26)20-17/h1-2,5-10H,3-4,11-12H2,(H,19,20) |
| InChIKey | OTENBFAFBBLNLI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate?
The IUPAC name of 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate (CID 135402571) is 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate.
What is the SMILES notation for 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate?
The canonical SMILES for 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate is O=C(OCCCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate?
The InChIKey is OTENBFAFBBLNLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O6S/c22-18(13-7-9-14(10-8-13)21(23)24)27-12-4-3-11-19-17-15-5-1-2-6-16(15)28(25,26)20-17/h1-2,5-10H,3-4,11-12H2,(H,19,20).
What are the key properties of 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate?
4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate has a molecular weight of 403.42 g/mol, XLogP of 2.27, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 4-nitrobenzoate is sourced from PubChem (CID 135402571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).