C22H26N4O5S2 — CID 135402578
N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 135402578) has the molecular formula C22H26N4O5S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 135402578 |
| Molecular Formula | C22H26N4O5S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26N4O5S2/c27-22(17-9-11-18(12-10-17)33(30,31)26-15-4-1-5-16-26)24-14-6-13-23-21-19-7-2-3-8-20(19)32(28,29)25-21/h2-3,7-12H,1,4-6,13-16H2,(H,23,25)(H,24,27) |
| InChIKey | LJKPUUFMJNSOKT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|