About ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate
ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate (PubChem CID 135402594) has the molecular formula C14H17N3O4
and a molecular weight of 291.31 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate |
| PubChem CID | 135402594 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate |
| SMILES | CCOC(=O)C(/C(N)=N/C(=O)Nc1ccccc1)=C(\C)O |
| InChI | InChI=1S/C14H17N3O4/c1-3-21-13(19)11(9(2)18)12(15)17-14(20)16-10-7-5-4-6-8-10/h4-8,18H,3H2,1-2H3,(H3,15,16,17,20)/b11-9+ |
| InChIKey | NLHAGZHMXVUYKJ-PKNBQFBNSA-N |
| XLogP | 1.97 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate?
The IUPAC name of ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate (CID 135402594) is ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate.
What is the SMILES notation for ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate?
The canonical SMILES for ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate is CCOC(=O)C(/C(N)=N/C(=O)Nc1ccccc1)=C(\C)O.
What is the InChIKey of ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate?
The InChIKey is NLHAGZHMXVUYKJ-PKNBQFBNSA-N. The full InChI is InChI=1S/C14H17N3O4/c1-3-21-13(19)11(9(2)18)12(15)17-14(20)16-10-7-5-4-6-8-10/h4-8,18H,3H2,1-2H3,(H3,15,16,17,20)/b11-9+.
What are the key properties of ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate?
ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate has a molecular weight of 291.31 g/mol, XLogP of 1.97, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-hydroxy-2-[(Z)-N'-(phenylcarbamoyl)carbamimidoyl]but-2-enoate is sourced from PubChem (CID 135402594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).