About 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate (PubChem CID 135402625) has the molecular formula C16H14N2O4S
and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate.
Molecular Properties
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate |
| PubChem CID | 135402625 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate |
| SMILES | O=C(OCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O4S/c19-16(12-6-2-1-3-7-12)22-11-10-17-15-13-8-4-5-9-14(13)23(20,21)18-15/h1-9H,10-11H2,(H,17,18) |
| InChIKey | UFMXYHMNPWJZER-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate?
The IUPAC name of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate (CID 135402625) is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate.
What is the SMILES notation for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate?
The canonical SMILES for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate is O=C(OCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1.
What is the InChIKey of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate?
The InChIKey is UFMXYHMNPWJZER-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4S/c19-16(12-6-2-1-3-7-12)22-11-10-17-15-13-8-4-5-9-14(13)23(20,21)18-15/h1-9H,10-11H2,(H,17,18).
What are the key properties of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate?
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate has a molecular weight of 330.37 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl benzoate is sourced from PubChem (CID 135402625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).