C22H24N2OS — CID 135402737
2-cyclohexylsulfanyl-4-(1-naphthalen-1-ylethyl)-1H-pyrimidin-6-one (PubChem CID 135402737) has the molecular formula C22H24N2OS and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-4-(1-naphthalen-1-ylethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclohexylsulfanyl-4-(1-naphthalen-1-ylethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135402737 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-cyclohexylsulfanyl-4-(1-naphthalen-1-ylethyl)-1H-pyrimidin-6-one |
| SMILES | CC(c1cc(=O)[nH]c(SC2CCCCC2)n1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H24N2OS/c1-15(18-13-7-9-16-8-5-6-12-19(16)18)20-14-21(25)24-22(23-20)26-17-10-3-2-4-11-17/h5-9,12-15,17H,2-4,10-11H2,1H3,(H,23,24,25) |
| InChIKey | WUTDUYRUVOILRH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |