C16H17F2N3O — CID 135402830
2-(cyclopentylamino)-4-[(2,6-difluorophenyl)methyl]-1H-pyrimidin-6-one (PubChem CID 135402830) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-(cyclopentylamino)-4-[(2,6-difluorophenyl)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-(cyclopentylamino)-4-[(2,6-difluorophenyl)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135402830 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(cyclopentylamino)-4-[(2,6-difluorophenyl)methyl]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(Cc2c(F)cccc2F)nc(NC2CCCC2)[nH]1 |
| InChI | InChI=1S/C16H17F2N3O/c17-13-6-3-7-14(18)12(13)8-11-9-15(22)21-16(20-11)19-10-4-1-2-5-10/h3,6-7,9-10H,1-2,4-5,8H2,(H2,19,20,21,22) |
| InChIKey | KBEMBRRTXOGSLG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |