C15H13Cl3N4O — CID 135402926
3,6-diethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135402926) has the molecular formula C15H13Cl3N4O and a molecular weight of 371.66 g/mol. Its IUPAC name is 3,6-diethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 3,6-diethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135402926 |
| Molecular Formula | C15H13Cl3N4O |
| Molecular Weight | 371.66 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 3,6-diethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCc1nc2c(c(CC)nn2-c2c(Cl)cc(Cl)cc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C15H13Cl3N4O/c1-3-10-12-14(19-11(4-2)20-15(12)23)22(21-10)13-8(17)5-7(16)6-9(13)18/h5-6H,3-4H2,1-2H3,(H,19,20,23) |
| InChIKey | DXPOPWAXDIQCHR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |