C17H17Cl3N4O2 — CID 135402939
3-ethyl-6-(4-hydroxybutyl)-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135402939) has the molecular formula C17H17Cl3N4O2 and a molecular weight of 415.71 g/mol. Its IUPAC name is 3-ethyl-6-(4-hydroxybutyl)-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-6-(4-hydroxybutyl)-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135402939 |
| Molecular Formula | C17H17Cl3N4O2 |
| Molecular Weight | 415.71 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 3-ethyl-6-(4-hydroxybutyl)-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCc1nn(-c2c(Cl)cc(Cl)cc2Cl)c2nc(CCCCO)[nH]c(=O)c12 |
| InChI | InChI=1S/C17H17Cl3N4O2/c1-2-12-14-16(21-13(22-17(14)26)5-3-4-6-25)24(23-12)15-10(19)7-9(18)8-11(15)20/h7-8,25H,2-6H2,1H3,(H,21,22,26) |
| InChIKey | PKENODBLXMNPET-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.71 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|