C21H18Cl3N5O — CID 135402953
6-[(3-amino-2-methylphenyl)methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135402953) has the molecular formula C21H18Cl3N5O and a molecular weight of 462.77 g/mol. Its IUPAC name is 6-[(3-amino-2-methylphenyl)methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[(3-amino-2-methylphenyl)methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135402953 |
| Molecular Formula | C21H18Cl3N5O |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 6-[(3-amino-2-methylphenyl)methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCc1nn(-c2c(Cl)cc(Cl)cc2Cl)c2nc(Cc3cccc(N)c3C)[nH]c(=O)c12 |
| InChI | InChI=1S/C21H18Cl3N5O/c1-3-16-18-20(29(28-16)19-13(23)8-12(22)9-14(19)24)26-17(27-21(18)30)7-11-5-4-6-15(25)10(11)2/h4-6,8-9H,3,7,25H2,1-2H3,(H,26,27,30) |
| InChIKey | JNWVFIUTIMINMS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|