C20H16Cl3N5O — CID 135402960
6-[(4-aminophenyl)methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135402960) has the molecular formula C20H16Cl3N5O and a molecular weight of 448.74 g/mol. Its IUPAC name is 6-[(4-aminophenyl)methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[(4-aminophenyl)methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135402960 |
| Molecular Formula | C20H16Cl3N5O |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 6-[(4-aminophenyl)methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCc1nn(-c2c(Cl)cc(Cl)cc2Cl)c2nc(Cc3ccc(N)cc3)[nH]c(=O)c12 |
| InChI | InChI=1S/C20H16Cl3N5O/c1-2-15-17-19(28(27-15)18-13(22)8-11(21)9-14(18)23)25-16(26-20(17)29)7-10-3-5-12(24)6-4-10/h3-6,8-9H,2,7,24H2,1H3,(H,25,26,29) |
| InChIKey | NQLPFCPYRSGQGU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|