C22H20Cl3N5O — CID 135402964
6-[[4-(dimethylamino)phenyl]methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135402964) has the molecular formula C22H20Cl3N5O and a molecular weight of 476.80 g/mol. Its IUPAC name is 6-[[4-(dimethylamino)phenyl]methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[[4-(dimethylamino)phenyl]methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135402964 |
| Molecular Formula | C22H20Cl3N5O |
| Molecular Weight | 476.80 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 6-[[4-(dimethylamino)phenyl]methyl]-3-ethyl-1-(2,4,6-trichlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCc1nn(-c2c(Cl)cc(Cl)cc2Cl)c2nc(Cc3ccc(N(C)C)cc3)[nH]c(=O)c12 |
| InChI | InChI=1S/C22H20Cl3N5O/c1-4-17-19-21(30(28-17)20-15(24)10-13(23)11-16(20)25)26-18(27-22(19)31)9-12-5-7-14(8-6-12)29(2)3/h5-8,10-11H,4,9H2,1-3H3,(H,26,27,31) |
| InChIKey | LNHVIDCEVQNJTK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.80 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|