About 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide
1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide (PubChem CID 135403024) has the molecular formula C15H13N5O
and a molecular weight of 279.30 g/mol. Its IUPAC name is 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide |
| PubChem CID | 135403024 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccccc2)c2c1CCc1[nH]ncc1-2 |
| InChI | InChI=1S/C15H13N5O/c16-15(21)13-10-6-7-12-11(8-17-18-12)14(10)20(19-13)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,16,21)(H,17,18) |
| InChIKey | AONVCSVCAYXLEL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide?
The IUPAC name of 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide (CID 135403024) is 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide.
What is the SMILES notation for 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide?
The canonical SMILES for 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide is NC(=O)c1nn(-c2ccccc2)c2c1CCc1[nH]ncc1-2.
What is the InChIKey of 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide?
The InChIKey is AONVCSVCAYXLEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5O/c16-15(21)13-10-6-7-12-11(8-17-18-12)14(10)20(19-13)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,16,21)(H,17,18).
What are the key properties of 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide?
1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide has a molecular weight of 279.30 g/mol, XLogP of 1.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide is sourced from PubChem (CID 135403024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).