C16H16N6O2 — CID 135403045
1-(4-methoxyphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carbohydrazide (PubChem CID 135403045) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carbohydrazide.
| Compound Name | 1-(4-methoxyphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carbohydrazide |
|---|---|
| PubChem CID | 135403045 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carbohydrazide |
| SMILES | COc1ccc(-n2nc(C(=O)NN)c3c2-c2cn[nH]c2CC3)cc1 |
| InChI | InChI=1S/C16H16N6O2/c1-24-10-4-2-9(3-5-10)22-15-11(14(21-22)16(23)19-17)6-7-13-12(15)8-18-20-13/h2-5,8H,6-7,17H2,1H3,(H,18,20)(H,19,23) |
| InChIKey | MZSMIVBLQXHTFG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|