C19H19N5O3 — CID 135403047
1-(4-methoxyphenyl)-N-prop-2-enoxy-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide (PubChem CID 135403047) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-prop-2-enoxy-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N-prop-2-enoxy-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide |
|---|---|
| PubChem CID | 135403047 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-prop-2-enoxy-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxamide |
| SMILES | C=CCONC(=O)c1nn(-c2ccc(OC)cc2)c2c1CCc1[nH]ncc1-2 |
| InChI | InChI=1S/C19H19N5O3/c1-3-10-27-23-19(25)17-14-8-9-16-15(11-20-21-16)18(14)24(22-17)12-4-6-13(26-2)7-5-12/h3-7,11H,1,8-10H2,2H3,(H,20,21)(H,23,25) |
| InChIKey | JRTGMBDUUMBMPQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|