C21H25N5O4S — CID 135403049
ethyl 1-[4-(butylsulfamoyl)phenyl]-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate (PubChem CID 135403049) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is ethyl 1-[4-(butylsulfamoyl)phenyl]-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate.
| Compound Name | ethyl 1-[4-(butylsulfamoyl)phenyl]-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate |
|---|---|
| PubChem CID | 135403049 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | ethyl 1-[4-(butylsulfamoyl)phenyl]-5,6-dihydro-4H-pyrazolo[5,4-e]indazole-3-carboxylate |
| SMILES | CCCCNS(=O)(=O)c1ccc(-n2nc(C(=O)OCC)c3c2-c2cn[nH]c2CC3)cc1 |
| InChI | InChI=1S/C21H25N5O4S/c1-3-5-12-23-31(28,29)15-8-6-14(7-9-15)26-20-16(19(25-26)21(27)30-4-2)10-11-18-17(20)13-22-24-18/h6-9,13,23H,3-5,10-12H2,1-2H3,(H,22,24) |
| InChIKey | JUUPXCFAHCSJIF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|