About (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine
(Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine (PubChem CID 135403078) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine.
Molecular Properties
| Compound Name | (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine |
| PubChem CID | 135403078 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine |
| SMILES | CCCc1n[nH]c2c1/C(=N\OCC)CC(C)(C)C2 |
| InChI | InChI=1S/C14H23N3O/c1-5-7-10-13-11(16-15-10)8-14(3,4)9-12(13)17-18-6-2/h5-9H2,1-4H3,(H,15,16)/b17-12- |
| InChIKey | QFHQNBBVDSBWQI-ATVHPVEESA-N |
| XLogP | 3.08 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine?
The IUPAC name of (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine (CID 135403078) is (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine.
What is the SMILES notation for (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine?
The canonical SMILES for (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine is CCCc1n[nH]c2c1/C(=N\OCC)CC(C)(C)C2.
What is the InChIKey of (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine?
The InChIKey is QFHQNBBVDSBWQI-ATVHPVEESA-N. The full InChI is InChI=1S/C14H23N3O/c1-5-7-10-13-11(16-15-10)8-14(3,4)9-12(13)17-18-6-2/h5-9H2,1-4H3,(H,15,16)/b17-12-.
What are the key properties of (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine?
(Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine has a molecular weight of 249.36 g/mol, XLogP of 3.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethoxy-6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-imine is sourced from PubChem (CID 135403078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).