C38H34N4O — CID 135403238
3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-21H-porphyrin-2-ol (PubChem CID 135403238) has the molecular formula C38H34N4O and a molecular weight of 562.72 g/mol. Its IUPAC name is 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-21H-porphyrin-2-ol.
| Compound Name | 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-21H-porphyrin-2-ol |
|---|---|
| PubChem CID | 135403238 |
| Molecular Formula | C38H34N4O |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-21H-porphyrin-2-ol |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C=C3\NC(=C(O)C3(C)C)/C=C3/C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C38H34N4O/c1-21-7-9-25(10-8-21)35-28-13-12-27(40-28)20-33-38(5,6)37(43)32(42-33)19-26-11-14-30(39-26)36(31-16-15-29(35)41-31)34-23(3)17-22(2)18-24(34)4/h7-20,42-43H,1-6H3/b26-19-,33-20-,35-28-,36-31+ |
| InChIKey | QSPUYUUWFSXSSC-NOSFPFGCSA-N |
| XLogP | 8.26 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |