C42H41IN4O — CID 135403240
10-(3,5-ditert-butylphenyl)-15-(4-iodophenyl)-3,3-dimethyl-21H-porphyrin-2-ol (PubChem CID 135403240) has the molecular formula C42H41IN4O and a molecular weight of 744.72 g/mol. Its IUPAC name is 10-(3,5-ditert-butylphenyl)-15-(4-iodophenyl)-3,3-dimethyl-21H-porphyrin-2-ol.
| Compound Name | 10-(3,5-ditert-butylphenyl)-15-(4-iodophenyl)-3,3-dimethyl-21H-porphyrin-2-ol |
|---|---|
| PubChem CID | 135403240 |
| Molecular Formula | C42H41IN4O |
| Molecular Weight | 744.72 g/mol |
| Exact Mass | 744.23 |
| IUPAC Name | 10-(3,5-ditert-butylphenyl)-15-(4-iodophenyl)-3,3-dimethyl-21H-porphyrin-2-ol |
| SMILES | CC1(C)C(O)=C2/C=C3/C=CC(=N3)/C(c3ccc(I)cc3)=C3/C=CC(=N3)/C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=C3/C=CC(=N3)/C=C/1N2 |
| InChI | InChI=1S/C42H41IN4O/c1-40(2,3)26-19-25(20-27(21-26)41(4,5)6)38-32-16-14-30(45-32)23-36-42(7,8)39(48)35(47-36)22-29-13-15-31(44-29)37(33-17-18-34(38)46-33)24-9-11-28(43)12-10-24/h9-23,47-48H,1-8H3/b29-22-,36-23-,37-33-,38-32- |
| InChIKey | TZANGPFNMJVZED-SLFPAONASA-N |
| XLogP | 10.22 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.72 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|