About 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one
2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 135403365) has the molecular formula C10H7N5O
and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 135403365 |
| Molecular Formula | C10H7N5O |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1[nH]cnc2nn(-c3ccccc3)nc12 |
| InChI | InChI=1S/C10H7N5O/c16-10-8-9(11-6-12-10)14-15(13-8)7-4-2-1-3-5-7/h1-6H,(H,11,12,14,16) |
| InChIKey | WDSLDFYBUSHAEM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one (CID 135403365) is 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one is O=c1[nH]cnc2nn(-c3ccccc3)nc12.
What is the InChIKey of 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The InChIKey is WDSLDFYBUSHAEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5O/c16-10-8-9(11-6-12-10)14-15(13-8)7-4-2-1-3-5-7/h1-6H,(H,11,12,14,16).
What are the key properties of 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one?
2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one has a molecular weight of 213.20 g/mol, XLogP of 0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-6H-triazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 135403365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).