C5H10N2S — CID 135403375
N,5-dimethyl-1,3-thiazolidin-2-imine (PubChem CID 135403375) has the molecular formula C5H10N2S and a molecular weight of 130.22 g/mol. Its IUPAC name is N,5-dimethyl-1,3-thiazolidin-2-imine.
| Compound Name | N,5-dimethyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135403375 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | N,5-dimethyl-1,3-thiazolidin-2-imine |
| SMILES | C/N=C1/NCC(C)S1 |
| InChI | InChI=1S/C5H10N2S/c1-4-3-7-5(6-2)8-4/h4H,3H2,1-2H3,(H,6,7) |
| InChIKey | RMUKYRGITOHRGW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|