About 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one
6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135403384) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 135403384 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CN(C)c1nc2[nH]ncc2c(=O)[nH]1 |
| InChI | InChI=1S/C7H9N5O/c1-12(2)7-9-5-4(3-8-11-5)6(13)10-7/h3H,1-2H3,(H2,8,9,10,11,13) |
| InChIKey | QLCHWMXKQWIKKA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (CID 135403384) is 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one is CN(C)c1nc2[nH]ncc2c(=O)[nH]1.
What is the InChIKey of 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is QLCHWMXKQWIKKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c1-12(2)7-9-5-4(3-8-11-5)6(13)10-7/h3H,1-2H3,(H2,8,9,10,11,13).
What are the key properties of 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 179.18 g/mol, XLogP of -0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 135403384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).