C18H13FN8O5 — CID 135403455
4-[(Z)-[[6-(2-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenol (PubChem CID 135403455) has the molecular formula C18H13FN8O5 and a molecular weight of 440.35 g/mol. Its IUPAC name is 4-[(Z)-[[6-(2-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenol.
| Compound Name | 4-[(Z)-[[6-(2-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 135403455 |
| Molecular Formula | C18H13FN8O5 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-[(Z)-[[6-(2-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenol |
| SMILES | COc1cc(/C=N\Nc2nc3nonc3nc2Nc2ccccc2F)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H13FN8O5/c1-31-13-7-9(6-12(14(13)28)27(29)30)8-20-24-16-15(21-11-5-3-2-4-10(11)19)22-17-18(23-16)26-32-25-17/h2-8,28H,1H3,(H,21,22,25)(H,23,24,26)/b20-8- |
| InChIKey | GENGETSYCDWJLC-ZBKNUEDVSA-N |
| XLogP | 2.96 |
| TPSA | 173.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|