About 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile
3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile (PubChem CID 135403544) has the molecular formula C9H4Cl2N4O2
and a molecular weight of 271.06 g/mol. Its IUPAC name is 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile |
| PubChem CID | 135403544 |
| Molecular Formula | C9H4Cl2N4O2 |
| Molecular Weight | 271.06 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile |
| SMILES | N#Cc1c(N)[n+]([O-])c2cc(Cl)c(Cl)cc2[n+]1[O-] |
| InChI | InChI=1S/C9H4Cl2N4O2/c10-4-1-6-7(2-5(4)11)15(17)9(13)8(3-12)14(6)16/h1-2H,13H2 |
| InChIKey | GCSYYCFQMALOSD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.06 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile?
The IUPAC name of 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile (CID 135403544) is 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile.
What is the SMILES notation for 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile?
The canonical SMILES for 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile is N#Cc1c(N)[n+]([O-])c2cc(Cl)c(Cl)cc2[n+]1[O-].
What is the InChIKey of 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile?
The InChIKey is GCSYYCFQMALOSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Cl2N4O2/c10-4-1-6-7(2-5(4)11)15(17)9(13)8(3-12)14(6)16/h1-2H,13H2.
What are the key properties of 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile?
3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile has a molecular weight of 271.06 g/mol, XLogP of 0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6,7-dichloro-1,4-dioxidoquinoxaline-1,4-diium-2-carbonitrile is sourced from PubChem (CID 135403544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).