C18H22N2O3 — CID 135403575
ethyl (2E)-2-(4a-methyl-2,3,4,10b-tetrahydro-1H-phenanthridin-6-yl)-2-hydroxyiminoacetate (PubChem CID 135403575) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is ethyl (2E)-2-(4a-methyl-2,3,4,10b-tetrahydro-1H-phenanthridin-6-yl)-2-hydroxyiminoacetate.
| Compound Name | ethyl (2E)-2-(4a-methyl-2,3,4,10b-tetrahydro-1H-phenanthridin-6-yl)-2-hydroxyiminoacetate |
|---|---|
| PubChem CID | 135403575 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | ethyl (2E)-2-(4a-methyl-2,3,4,10b-tetrahydro-1H-phenanthridin-6-yl)-2-hydroxyiminoacetate |
| SMILES | CCOC(=O)/C(=N/O)C1=NC2(C)CCCCC2c2ccccc21 |
| InChI | InChI=1S/C18H22N2O3/c1-3-23-17(21)16(20-22)15-13-9-5-4-8-12(13)14-10-6-7-11-18(14,2)19-15/h4-5,8-9,14,22H,3,6-7,10-11H2,1-2H3/b20-16+ |
| InChIKey | BFADVJOJDVBMSX-CAPFRKAQSA-N |
| XLogP | 3.30 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|