About 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate (PubChem CID 135403665) has the molecular formula C17H16N2O5S
and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate.
Molecular Properties
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate |
| PubChem CID | 135403665 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H16N2O5S/c1-23-14-8-4-2-6-12(14)17(20)24-11-10-18-16-13-7-3-5-9-15(13)25(21,22)19-16/h2-9H,10-11H2,1H3,(H,18,19) |
| InChIKey | BYEWNDHQQPYUCA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate?
The IUPAC name of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate (CID 135403665) is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate.
What is the SMILES notation for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate?
The canonical SMILES for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate is COc1ccccc1C(=O)OCC/N=C1\NS(=O)(=O)c2ccccc21.
What is the InChIKey of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate?
The InChIKey is BYEWNDHQQPYUCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O5S/c1-23-14-8-4-2-6-12(14)17(20)24-11-10-18-16-13-7-3-5-9-15(13)25(21,22)19-16/h2-9H,10-11H2,1H3,(H,18,19).
What are the key properties of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate?
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate has a molecular weight of 360.39 g/mol, XLogP of 1.59, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-methoxybenzoate is sourced from PubChem (CID 135403665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).