C18H21N3O2 — CID 135403746
1-[6-(1H-benzimidazol-2-ylmethylimino)-2-hydroxy-4,4-dimethylcyclohexen-1-yl]ethanone (PubChem CID 135403746) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 1-[6-(1H-benzimidazol-2-ylmethylimino)-2-hydroxy-4,4-dimethylcyclohexen-1-yl]ethanone.
| Compound Name | 1-[6-(1H-benzimidazol-2-ylmethylimino)-2-hydroxy-4,4-dimethylcyclohexen-1-yl]ethanone |
|---|---|
| PubChem CID | 135403746 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-[6-(1H-benzimidazol-2-ylmethylimino)-2-hydroxy-4,4-dimethylcyclohexen-1-yl]ethanone |
| SMILES | CC(=O)C1=C(O)CC(C)(C)C/C1=N\Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H21N3O2/c1-11(22)17-14(8-18(2,3)9-15(17)23)19-10-16-20-12-6-4-5-7-13(12)21-16/h4-7,23H,8-10H2,1-3H3,(H,20,21)/b19-14+ |
| InChIKey | CZTHSFCXPOBLKB-XMHGGMMESA-N |
| XLogP | 3.72 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|