C6H5N5O3 — CID 135403796
2-amino-5,8-dihydro-3H-pteridine-4,6,7-trione (PubChem CID 135403796) has the molecular formula C6H5N5O3 and a molecular weight of 195.14 g/mol. Its IUPAC name is 2-amino-5,8-dihydro-3H-pteridine-4,6,7-trione.
| Compound Name | 2-amino-5,8-dihydro-3H-pteridine-4,6,7-trione |
|---|---|
| PubChem CID | 135403796 |
| Molecular Formula | C6H5N5O3 |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2-amino-5,8-dihydro-3H-pteridine-4,6,7-trione |
| SMILES | Nc1nc2[nH]c(=O)c(=O)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C6H5N5O3/c7-6-10-2-1(3(12)11-6)8-4(13)5(14)9-2/h(H,8,13)(H4,7,9,10,11,12,14) |
| InChIKey | SFLOGVVDXPCWGR-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|