C9H6N4S — CID 135403808
2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione (PubChem CID 135403808) has the molecular formula C9H6N4S and a molecular weight of 202.24 g/mol. Its IUPAC name is 2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione.
| Compound Name | 2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione |
|---|---|
| PubChem CID | 135403808 |
| Molecular Formula | C9H6N4S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione |
| SMILES | S=c1nc2[nH]c3ccccc3c2n[nH]1 |
| InChI | InChI=1S/C9H6N4S/c14-9-11-8-7(12-13-9)5-3-1-2-4-6(5)10-8/h1-4H,(H2,10,11,13,14) |
| InChIKey | RPEJKVRRTJDBSN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|