C21H21FN8O2 — CID 135403973
5-(diethylamino)-2-[(E)-[[6-(4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]phenol (PubChem CID 135403973) has the molecular formula C21H21FN8O2 and a molecular weight of 436.45 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(E)-[[6-(4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 5-(diethylamino)-2-[(E)-[[6-(4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135403973 |
| Molecular Formula | C21H21FN8O2 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 5-(diethylamino)-2-[(E)-[[6-(4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N/Nc2nc3nonc3nc2Nc2ccc(F)cc2)c(O)c1 |
| InChI | InChI=1S/C21H21FN8O2/c1-3-30(4-2)16-10-5-13(17(31)11-16)12-23-27-19-18(24-15-8-6-14(22)7-9-15)25-20-21(26-19)29-32-28-20/h5-12,31H,3-4H2,1-2H3,(H,24,25,28)(H,26,27,29)/b23-12+ |
| InChIKey | YEQJIOJCOGIMBF-FSJBWODESA-N |
| XLogP | 3.89 |
| TPSA | 124.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|