About ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate
ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate (PubChem CID 135404100) has the molecular formula C13H13F2N3O4
and a molecular weight of 313.26 g/mol. Its IUPAC name is ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate.
Molecular Properties
| Compound Name | ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate |
| PubChem CID | 135404100 |
| Molecular Formula | C13H13F2N3O4 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate |
| SMILES | CCOC(=O)C(=N\O)/C(C)=N/NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H13F2N3O4/c1-3-22-13(20)11(18-21)7(2)16-17-12(19)10-8(14)5-4-6-9(10)15/h4-6,21H,3H2,1-2H3,(H,17,19)/b16-7+,18-11- |
| InChIKey | MFLXZWMOOJFDAE-VBQYLHGJSA-N |
| XLogP | 1.46 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate?
The IUPAC name of ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate (CID 135404100) is ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate.
What is the SMILES notation for ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate?
The canonical SMILES for ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate is CCOC(=O)C(=N\O)/C(C)=N/NC(=O)c1c(F)cccc1F.
What is the InChIKey of ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate?
The InChIKey is MFLXZWMOOJFDAE-VBQYLHGJSA-N. The full InChI is InChI=1S/C13H13F2N3O4/c1-3-22-13(20)11(18-21)7(2)16-17-12(19)10-8(14)5-4-6-9(10)15/h4-6,21H,3H2,1-2H3,(H,17,19)/b16-7+,18-11-.
What are the key properties of ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate?
ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate has a molecular weight of 313.26 g/mol, XLogP of 1.46, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z,3E)-3-[(2,6-difluorobenzoyl)hydrazinylidene]-2-hydroxyiminobutanoate is sourced from PubChem (CID 135404100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).