C56H54N4 — CID 135404289
5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin (PubChem CID 135404289) has the molecular formula C56H54N4 and a molecular weight of 783.08 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135404289 |
| Molecular Formula | C56H54N4 |
| Molecular Weight | 783.08 g/mol |
| Exact Mass | 782.43 |
| IUPAC Name | 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C56H54N4/c1-29-21-33(5)49(34(6)22-29)53-41-13-15-43(57-41)54(50-35(7)23-30(2)24-36(50)8)45-17-19-47(59-45)56(52-39(11)27-32(4)28-40(52)12)48-20-18-46(60-48)55(44-16-14-42(53)58-44)51-37(9)25-31(3)26-38(51)10/h13-28,57,60H,1-12H3/b53-41+,53-42+,54-43+,54-45+,55-44+,55-46+,56-47+,56-48+ |
| InChIKey | KBIOUJDBIXSYJT-RNWYWIMESA-N |
| XLogP | 15.02 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.08 |
| LogP ≤ 5 | 15.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |