C13H20ClN5 — CID 135404371
4-methyl-3-phenyl-4-propyl-1H-1,3,5-triazin-3-ium-2,6-diamine chloride (PubChem CID 135404371) has the molecular formula C13H20ClN5 and a molecular weight of 281.79 g/mol. Its IUPAC name is 4-methyl-3-phenyl-4-propyl-1H-1,3,5-triazin-3-ium-2,6-diamine chloride.
| Compound Name | 4-methyl-3-phenyl-4-propyl-1H-1,3,5-triazin-3-ium-2,6-diamine chloride |
|---|---|
| PubChem CID | 135404371 |
| Molecular Formula | C13H20ClN5 |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-methyl-3-phenyl-4-propyl-1H-1,3,5-triazin-3-ium-2,6-diamine chloride |
| SMILES | CCCC1(C)N=C(N)NC(N)=[N+]1c1ccccc1.[Cl-] |
| InChI | InChI=1S/C13H19N5.ClH/c1-3-9-13(2)17-11(14)16-12(15)18(13)10-7-5-4-6-8-10;/h4-8H,3,9H2,1-2H3,(H4,14,15,16,17);1H |
| InChIKey | WOJGBWAGKJHARL-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|