C11H14N2O3 — CID 135404692
(1S,4R)-1-(2-diazoacetyl)-4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-one (PubChem CID 135404692) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is (1S,4R)-1-(2-diazoacetyl)-4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1S,4R)-1-(2-diazoacetyl)-4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 135404692 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (1S,4R)-1-(2-diazoacetyl)-4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-one |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)C=[N+]=[N-])OC2=O |
| InChI | InChI=1S/C11H14N2O3/c1-9(2)10(3)4-5-11(9,16-8(10)15)7(14)6-13-12/h6H,4-5H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | NIJRQSGTUHFIOL-WDEREUQCSA-N |
| XLogP | 0.98 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|