C12H8Br2N4O4 — CID 135404972
2,7-bis(bromomethyl)-5,10-dihydroxy-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione (PubChem CID 135404972) has the molecular formula C12H8Br2N4O4 and a molecular weight of 432.03 g/mol. Its IUPAC name is 2,7-bis(bromomethyl)-5,10-dihydroxy-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione.
| Compound Name | 2,7-bis(bromomethyl)-5,10-dihydroxy-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione |
|---|---|
| PubChem CID | 135404972 |
| Molecular Formula | C12H8Br2N4O4 |
| Molecular Weight | 432.03 g/mol |
| Exact Mass | 429.89 |
| IUPAC Name | 2,7-bis(bromomethyl)-5,10-dihydroxy-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione |
| SMILES | O=c1[nH]c(CBr)nc2c(O)c3c(=O)[nH]c(CBr)nc3c(O)c12 |
| InChI | InChI=1S/C12H8Br2N4O4/c13-1-3-15-7-5(11(21)17-3)10(20)8-6(9(7)19)12(22)18-4(2-14)16-8/h19-20H,1-2H2,(H,15,17,21)(H,16,18,22) |
| InChIKey | XUFDNBDPDWHSEB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.03 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|